About 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one
2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one (PubChem CID 59505385) has the molecular formula C15H20O
and a molecular weight of 216.32 g/mol. Its IUPAC name is 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one.
Molecular Properties
| Compound Name | 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one |
| PubChem CID | 59505385 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one |
| SMILES | CC1CCc2cccc(C(=O)C(C)(C)C)c21 |
| InChI | InChI=1S/C15H20O/c1-10-8-9-11-6-5-7-12(13(10)11)14(16)15(2,3)4/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | AECPRTSOCLNGFM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one?
The IUPAC name of 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one (CID 59505385) is 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one.
What is the SMILES notation for 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one?
The canonical SMILES for 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one is CC1CCc2cccc(C(=O)C(C)(C)C)c21.
What is the InChIKey of 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one?
The InChIKey is AECPRTSOCLNGFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O/c1-10-8-9-11-6-5-7-12(13(10)11)14(16)15(2,3)4/h5-7,10H,8-9H2,1-4H3.
What are the key properties of 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one?
2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one has a molecular weight of 216.32 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1-(3-methyl-2,3-dihydro-1H-inden-4-yl)propan-1-one is sourced from PubChem (CID 59505385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).