About chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane
chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane (PubChem CID 59505386) has the molecular formula C10H13ClO2S
and a molecular weight of 232.73 g/mol. Its IUPAC name is chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane |
| PubChem CID | 59505386 |
| Molecular Formula | C10H13ClO2S |
| Molecular Weight | 232.73 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane |
| SMILES | C=S(=O)(Cl)c1c(C)cc(OC)cc1C |
| InChI | InChI=1S/C10H13ClO2S/c1-7-5-9(13-3)6-8(2)10(7)14(4,11)12/h5-6H,4H2,1-3H3 |
| InChIKey | PPRRLMLDRXQVKM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.73 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane?
The IUPAC name of chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane (CID 59505386) is chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane.
What is the SMILES notation for chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane?
The canonical SMILES for chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane is C=S(=O)(Cl)c1c(C)cc(OC)cc1C.
What is the InChIKey of chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane?
The InChIKey is PPRRLMLDRXQVKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO2S/c1-7-5-9(13-3)6-8(2)10(7)14(4,11)12/h5-6H,4H2,1-3H3.
What are the key properties of chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane?
chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane has a molecular weight of 232.73 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(4-methoxy-2,6-dimethylphenyl)-methylidene-oxo-λ6-sulfane is sourced from PubChem (CID 59505386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).