C22H39N3O — CID 59505508
N-(1-azabicyclo[2.2.2]octan-3-yl)-3-tert-butyl-3-azaspiro[5.5]undecane-9-carboxamide (PubChem CID 59505508) has the molecular formula C22H39N3O and a molecular weight of 361.57 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-3-tert-butyl-3-azaspiro[5.5]undecane-9-carboxamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-3-tert-butyl-3-azaspiro[5.5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 59505508 |
| Molecular Formula | C22H39N3O |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.31 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-3-tert-butyl-3-azaspiro[5.5]undecane-9-carboxamide |
| SMILES | CC(C)(C)N1CCC2(CCC(C(=O)NC3CN4CCC3CC4)CC2)CC1 |
| InChI | InChI=1S/C22H39N3O/c1-21(2,3)25-14-10-22(11-15-25)8-4-18(5-9-22)20(26)23-19-16-24-12-6-17(19)7-13-24/h17-19H,4-16H2,1-3H3,(H,23,26) |
| InChIKey | PTNIRCUQOQHQPY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |