C33H33N7O — CID 59506330
3-benzyl-9-[(4-methoxyphenyl)methyl]-N-[2-(7-methyl-1H-indol-3-yl)ethyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine (PubChem CID 59506330) has the molecular formula C33H33N7O and a molecular weight of 543.68 g/mol. Its IUPAC name is 3-benzyl-9-[(4-methoxyphenyl)methyl]-N-[2-(7-methyl-1H-indol-3-yl)ethyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine.
| Compound Name | 3-benzyl-9-[(4-methoxyphenyl)methyl]-N-[2-(7-methyl-1H-indol-3-yl)ethyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 59506330 |
| Molecular Formula | C33H33N7O |
| Molecular Weight | 543.68 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 3-benzyl-9-[(4-methoxyphenyl)methyl]-N-[2-(7-methyl-1H-indol-3-yl)ethyl]-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraen-6-amine |
| SMILES | COc1ccc(CN2CCc3nn(Cc4ccccc4)c4nc(NCCc5c[nH]c6c(C)cccc56)nc2c34)cc1 |
| InChI | InChI=1S/C33H33N7O/c1-22-7-6-10-27-25(19-35-30(22)27)15-17-34-33-36-31-29-28(16-18-39(31)20-24-11-13-26(41-2)14-12-24)38-40(32(29)37-33)21-23-8-4-3-5-9-23/h3-14,19,35H,15-18,20-21H2,1-2H3,(H,34,36,37) |
| InChIKey | XZBUKYLFULVJSA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.68 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |