C31H32N8O — CID 59506416
3-benzyl-9-[(4-methoxyphenyl)methyl]-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene (PubChem CID 59506416) has the molecular formula C31H32N8O and a molecular weight of 532.65 g/mol. Its IUPAC name is 3-benzyl-9-[(4-methoxyphenyl)methyl]-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene.
| Compound Name | 3-benzyl-9-[(4-methoxyphenyl)methyl]-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 59506416 |
| Molecular Formula | C31H32N8O |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 3-benzyl-9-[(4-methoxyphenyl)methyl]-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,7,9-tetrazatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene |
| SMILES | COc1ccc(CN2CCc3nn(Cc4ccccc4)c4cc(N5CCN(c6cnccn6)CC5)nc2c34)cc1 |
| InChI | InChI=1S/C31H32N8O/c1-40-25-9-7-24(8-10-25)21-38-14-11-26-30-27(39(35-26)22-23-5-3-2-4-6-23)19-28(34-31(30)38)36-15-17-37(18-16-36)29-20-32-12-13-33-29/h2-10,12-13,19-20H,11,14-18,21-22H2,1H3 |
| InChIKey | CRBLWFSTKAWZKM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |