C24H27N9O — CID 59506516
9-[(4-methoxyphenyl)methyl]-3-methyl-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene (PubChem CID 59506516) has the molecular formula C24H27N9O and a molecular weight of 457.54 g/mol. Its IUPAC name is 9-[(4-methoxyphenyl)methyl]-3-methyl-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene.
| Compound Name | 9-[(4-methoxyphenyl)methyl]-3-methyl-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene |
|---|---|
| PubChem CID | 59506516 |
| Molecular Formula | C24H27N9O |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 9-[(4-methoxyphenyl)methyl]-3-methyl-6-(4-pyrazin-2-ylpiperazin-1-yl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1,4(12),5,7-tetraene |
| SMILES | COc1ccc(CN2CCc3nn(C)c4nc(N5CCN(c6cnccn6)CC5)nc2c34)cc1 |
| InChI | InChI=1S/C24H27N9O/c1-30-22-21-19(29-30)7-10-33(16-17-3-5-18(34-2)6-4-17)23(21)28-24(27-22)32-13-11-31(12-14-32)20-15-25-8-9-26-20/h3-6,8-9,15H,7,10-14,16H2,1-2H3 |
| InChIKey | CVKMPFLEVFICCN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |