C21H26N6 — CID 59506544
9-benzyl-N-(cyclohexylmethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine (PubChem CID 59506544) has the molecular formula C21H26N6 and a molecular weight of 362.48 g/mol. Its IUPAC name is 9-benzyl-N-(cyclohexylmethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine.
| Compound Name | 9-benzyl-N-(cyclohexylmethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 59506544 |
| Molecular Formula | C21H26N6 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 9-benzyl-N-(cyclohexylmethyl)-2,3,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-1(12),3,5,7-tetraen-6-amine |
| SMILES | c1ccc(CN2CCc3[nH]nc4nc(NCC5CCCCC5)nc2c34)cc1 |
| InChI | InChI=1S/C21H26N6/c1-3-7-15(8-4-1)13-22-21-23-19-18-17(25-26-19)11-12-27(20(18)24-21)14-16-9-5-2-6-10-16/h2,5-6,9-10,15H,1,3-4,7-8,11-14H2,(H2,22,23,24,25,26) |
| InChIKey | MFXVRIBFQAIKRC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |