C28H32F2N4OSi — CID 59506753
(3-amino-2,6-difluorophenyl)-[5-pyridin-3-yl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 59506753) has the molecular formula C28H32F2N4OSi and a molecular weight of 506.67 g/mol. Its IUPAC name is (3-amino-2,6-difluorophenyl)-[5-pyridin-3-yl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (3-amino-2,6-difluorophenyl)-[5-pyridin-3-yl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 59506753 |
| Molecular Formula | C28H32F2N4OSi |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (3-amino-2,6-difluorophenyl)-[5-pyridin-3-yl-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1cc(C(=O)c2c(F)ccc(N)c2F)c2cc(-c3cccnc3)cnc21 |
| InChI | InChI=1S/C28H32F2N4OSi/c1-16(2)36(17(3)4,18(5)6)34-15-22(27(35)25-23(29)9-10-24(31)26(25)30)21-12-20(14-33-28(21)34)19-8-7-11-32-13-19/h7-18H,31H2,1-6H3 |
| InChIKey | JAXDMKDXWOAMFB-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|