C22H16N4O2 — CID 59507079
11-[1-(2-phenylphenyl)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 59507079) has the molecular formula C22H16N4O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 11-[1-(2-phenylphenyl)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 11-[1-(2-phenylphenyl)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 59507079 |
| Molecular Formula | C22H16N4O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 11-[1-(2-phenylphenyl)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | CC(c1ccccc1-c1ccccc1)N1C(=O)c2cnc3[nH]ncc3c2C1=O |
| InChI | InChI=1S/C22H16N4O2/c1-13(15-9-5-6-10-16(15)14-7-3-2-4-8-14)26-21(27)18-11-23-20-17(12-24-25-20)19(18)22(26)28/h2-13H,1H3,(H,23,24,25) |
| InChIKey | RTJDWOIRZRBNLB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|