C13H11N5O3 — CID 59507209
11-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 59507209) has the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. Its IUPAC name is 11-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 11-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 59507209 |
| Molecular Formula | C13H11N5O3 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 11-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | O=C1CC[C@@H](CN2C(=O)c3cnc4[nH]ncc4c3C2=O)N1 |
| InChI | InChI=1S/C13H11N5O3/c19-9-2-1-6(16-9)5-18-12(20)8-3-14-11-7(4-15-17-11)10(8)13(18)21/h3-4,6H,1-2,5H2,(H,16,19)(H,14,15,17)/t6-/m0/s1 |
| InChIKey | OMYKNCDLBOOXGB-LURJTMIESA-N |
| XLogP | -0.17 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|