C37H29N5O4 — CID 59507215
N-[3-[5-[(4-methoxyphenyl)methyl]-10,12-dioxo-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-3-yl]phenyl]benzamide (PubChem CID 59507215) has the molecular formula C37H29N5O4 and a molecular weight of 607.67 g/mol. Its IUPAC name is N-[3-[5-[(4-methoxyphenyl)methyl]-10,12-dioxo-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-3-yl]phenyl]benzamide.
| Compound Name | N-[3-[5-[(4-methoxyphenyl)methyl]-10,12-dioxo-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 59507215 |
| Molecular Formula | C37H29N5O4 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | N-[3-[5-[(4-methoxyphenyl)methyl]-10,12-dioxo-11-(2-phenylethyl)-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraen-3-yl]phenyl]benzamide |
| SMILES | COc1ccc(Cn2nc(-c3cccc(NC(=O)c4ccccc4)c3)c3c4c(cnc32)C(=O)N(CCc2ccccc2)C4=O)cc1 |
| InChI | InChI=1S/C37H29N5O4/c1-46-29-17-15-25(16-18-29)23-42-34-32(31-30(22-38-34)36(44)41(37(31)45)20-19-24-9-4-2-5-10-24)33(40-42)27-13-8-14-28(21-27)39-35(43)26-11-6-3-7-12-26/h2-18,21-22H,19-20,23H2,1H3,(H,39,43) |
| InChIKey | SPXSSEBZMLOQNO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|