C14H11N5O2S — CID 59507221
11-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 59507221) has the molecular formula C14H11N5O2S and a molecular weight of 313.34 g/mol. Its IUPAC name is 11-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 11-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 59507221 |
| Molecular Formula | C14H11N5O2S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 11-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | Cc1ncsc1CCN1C(=O)c2cnc3[nH]ncc3c2C1=O |
| InChI | InChI=1S/C14H11N5O2S/c1-7-10(22-6-16-7)2-3-19-13(20)9-4-15-12-8(5-17-18-12)11(9)14(19)21/h4-6H,2-3H2,1H3,(H,15,17,18) |
| InChIKey | JBBJVCLAYZKTTD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|