C20H14N4O2S — CID 59507227
11-(2-phenylethyl)-3-thiophen-3-yl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione (PubChem CID 59507227) has the molecular formula C20H14N4O2S and a molecular weight of 374.43 g/mol. Its IUPAC name is 11-(2-phenylethyl)-3-thiophen-3-yl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione.
| Compound Name | 11-(2-phenylethyl)-3-thiophen-3-yl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
|---|---|
| PubChem CID | 59507227 |
| Molecular Formula | C20H14N4O2S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 11-(2-phenylethyl)-3-thiophen-3-yl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,5,7-tetraene-10,12-dione |
| SMILES | O=C1c2cnc3n[nH]c(-c4ccsc4)c3c2C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C20H14N4O2S/c25-19-14-10-21-18-16(17(22-23-18)13-7-9-27-11-13)15(14)20(26)24(19)8-6-12-4-2-1-3-5-12/h1-5,7,9-11H,6,8H2,(H,21,22,23) |
| InChIKey | XNLKFQZDOHXLRR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|