C14H17N5O2 — CID 59507237
11-[2-(diethylamino)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 59507237) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 11-[2-(diethylamino)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 11-[2-(diethylamino)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 59507237 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 11-[2-(diethylamino)ethyl]-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | CCN(CC)CCN1C(=O)c2cnc3[nH]ncc3c2C1=O |
| InChI | InChI=1S/C14H17N5O2/c1-3-18(4-2)5-6-19-13(20)10-7-15-12-9(8-16-17-12)11(10)14(19)21/h7-8H,3-6H2,1-2H3,(H,15,16,17) |
| InChIKey | IYSFWCFAGUYYEU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|