About 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine
4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine (PubChem CID 59507617) has the molecular formula C8H8Cl2FN3O
and a molecular weight of 252.08 g/mol. Its IUPAC name is 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine.
Molecular Properties
| Compound Name | 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine |
| PubChem CID | 59507617 |
| Molecular Formula | C8H8Cl2FN3O |
| Molecular Weight | 252.08 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine |
| SMILES | Fc1c(Cl)nc(N2CCOCC2)nc1Cl |
| InChI | InChI=1S/C8H8Cl2FN3O/c9-6-5(11)7(10)13-8(12-6)14-1-3-15-4-2-14/h1-4H2 |
| InChIKey | ALVUPDSMBZYQSZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.08 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine?
The IUPAC name of 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine (CID 59507617) is 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine.
What is the SMILES notation for 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine?
The canonical SMILES for 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine is Fc1c(Cl)nc(N2CCOCC2)nc1Cl.
What is the InChIKey of 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine?
The InChIKey is ALVUPDSMBZYQSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2FN3O/c9-6-5(11)7(10)13-8(12-6)14-1-3-15-4-2-14/h1-4H2.
What are the key properties of 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine?
4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine has a molecular weight of 252.08 g/mol, XLogP of 1.76, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,6-dichloro-5-fluoropyrimidin-2-yl)morpholine is sourced from PubChem (CID 59507617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).