C21H20F3N7O2 — CID 59507832
5-[6-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-morpholin-4-ylpyrimidin-4-yl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 59507832) has the molecular formula C21H20F3N7O2 and a molecular weight of 459.43 g/mol. Its IUPAC name is 5-[6-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-morpholin-4-ylpyrimidin-4-yl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 5-[6-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-morpholin-4-ylpyrimidin-4-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 59507832 |
| Molecular Formula | C21H20F3N7O2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 5-[6-(2,3-dihydro-1,4-benzoxazin-4-yl)-2-morpholin-4-ylpyrimidin-4-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | Nc1ncc(-c2cc(N3CCOc4ccccc43)nc(N3CCOCC3)n2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C21H20F3N7O2/c22-21(23,24)18-13(12-26-19(25)29-18)14-11-17(28-20(27-14)30-5-8-32-9-6-30)31-7-10-33-16-4-2-1-3-15(16)31/h1-4,11-12H,5-10H2,(H2,25,26,29) |
| InChIKey | JTAHTRNZZWAWMT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|