C22H28N6O2 — CID 59508127
N-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]benzamide (PubChem CID 59508127) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]benzamide.
| Compound Name | N-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 59508127 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]benzamide |
| SMILES | CC1(C)c2[nH]nc(NC(=O)c3ccccc3)c2CN1C(=O)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C22H28N6O2/c1-22(2)18-17(19(25-24-18)23-20(29)15-7-4-3-5-8-15)14-28(22)21(30)27-12-11-26-10-6-9-16(26)13-27/h3-5,7-8,16H,6,9-14H2,1-2H3,(H2,23,24,25,29) |
| InChIKey | ASHZMTUTCRDWSP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |