C24H37N7O4 — CID 59508157
N-[5-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 59508157) has the molecular formula C24H37N7O4 and a molecular weight of 487.61 g/mol. Its IUPAC name is N-[5-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-[5-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 59508157 |
| Molecular Formula | C24H37N7O4 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | N-[5-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | COCCCN1C[C@H](C)N(C(=O)N2Cc3c(NC(=O)c4oc(C)nc4C)n[nH]c3C2(C)C)C[C@H]1C |
| InChI | InChI=1S/C24H37N7O4/c1-14-12-30(15(2)11-29(14)9-8-10-34-7)23(33)31-13-18-20(24(31,5)6)27-28-21(18)26-22(32)19-16(3)25-17(4)35-19/h14-15H,8-13H2,1-7H3,(H2,26,27,28,32)/t14-,15+/m1/s1 |
| InChIKey | IFJQHIVRQCBQER-CABCVRRESA-N |
| XLogP | 2.87 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|