C20H26N6O2S — CID 59508174
N-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]thiophene-2-carboxamide (PubChem CID 59508174) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is N-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59508174 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[5-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl)-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]thiophene-2-carboxamide |
| SMILES | CC1(C)c2[nH]nc(NC(=O)c3cccs3)c2CN1C(=O)N1CCN2CCCC2C1 |
| InChI | InChI=1S/C20H26N6O2S/c1-20(2)16-14(17(23-22-16)21-18(27)15-6-4-10-29-15)12-26(20)19(28)25-9-8-24-7-3-5-13(24)11-25/h4,6,10,13H,3,5,7-9,11-12H2,1-2H3,(H2,21,22,23,27) |
| InChIKey | YGRSDJVMUKDBOE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |