C25H40N8O3 — CID 59508219
3-ethyl-N-[5-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1-methylpyrazole-5-carboxamide (PubChem CID 59508219) has the molecular formula C25H40N8O3 and a molecular weight of 500.65 g/mol. Its IUPAC name is 3-ethyl-N-[5-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1-methylpyrazole-5-carboxamide.
| Compound Name | 3-ethyl-N-[5-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 59508219 |
| Molecular Formula | C25H40N8O3 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.32 |
| IUPAC Name | 3-ethyl-N-[5-[(2S,5R)-4-(3-methoxypropyl)-2,5-dimethylpiperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1-methylpyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2n[nH]c3c2CN(C(=O)N2C[C@@H](C)N(CCCOC)C[C@@H]2C)C3(C)C)n(C)n1 |
| InChI | InChI=1S/C25H40N8O3/c1-8-18-12-20(30(6)29-18)23(34)26-22-19-15-33(25(4,5)21(19)27-28-22)24(35)32-14-16(2)31(13-17(32)3)10-9-11-36-7/h12,16-17H,8-11,13-15H2,1-7H3,(H2,26,27,28,34)/t16-,17+/m1/s1 |
| InChIKey | ZZSXHBPUUSTVHU-SJORKVTESA-N |
| XLogP | 2.56 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|