C22H31N7O3 — CID 59508229
5-cyclopropyl-N-[6,6-dimethyl-5-[(2S,5R)-2,4,5-trimethylpiperazine-1-carbonyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1,2-oxazole-3-carboxamide (PubChem CID 59508229) has the molecular formula C22H31N7O3 and a molecular weight of 441.54 g/mol. Its IUPAC name is 5-cyclopropyl-N-[6,6-dimethyl-5-[(2S,5R)-2,4,5-trimethylpiperazine-1-carbonyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-cyclopropyl-N-[6,6-dimethyl-5-[(2S,5R)-2,4,5-trimethylpiperazine-1-carbonyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 59508229 |
| Molecular Formula | C22H31N7O3 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 5-cyclopropyl-N-[6,6-dimethyl-5-[(2S,5R)-2,4,5-trimethylpiperazine-1-carbonyl]-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]-1,2-oxazole-3-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)N2Cc3c(NC(=O)c4cc(C5CC5)on4)n[nH]c3C2(C)C)[C@@H](C)CN1C |
| InChI | InChI=1S/C22H31N7O3/c1-12-10-28(13(2)9-27(12)5)21(31)29-11-15-18(22(29,3)4)24-25-19(15)23-20(30)16-8-17(32-26-16)14-6-7-14/h8,12-14H,6-7,9-11H2,1-5H3,(H2,23,24,25,30)/t12-,13+/m1/s1 |
| InChIKey | QGALZKADVNRDNW-OLZOCXBDSA-N |
| XLogP | 2.72 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |