C25H36N8O3 — CID 59508250
N-[5-[(2S,5R)-2,5-dimethyl-4-(oxan-4-ylmethyl)piperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]pyrazine-2-carboxamide (PubChem CID 59508250) has the molecular formula C25H36N8O3 and a molecular weight of 496.62 g/mol. Its IUPAC name is N-[5-[(2S,5R)-2,5-dimethyl-4-(oxan-4-ylmethyl)piperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]pyrazine-2-carboxamide.
| Compound Name | N-[5-[(2S,5R)-2,5-dimethyl-4-(oxan-4-ylmethyl)piperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59508250 |
| Molecular Formula | C25H36N8O3 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | N-[5-[(2S,5R)-2,5-dimethyl-4-(oxan-4-ylmethyl)piperazine-1-carbonyl]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazol-3-yl]pyrazine-2-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)N2Cc3c(NC(=O)c4cnccn4)n[nH]c3C2(C)C)[C@@H](C)CN1CC1CCOCC1 |
| InChI | InChI=1S/C25H36N8O3/c1-16-13-32(17(2)12-31(16)14-18-5-9-36-10-6-18)24(35)33-15-19-21(25(33,3)4)29-30-22(19)28-23(34)20-11-26-7-8-27-20/h7-8,11,16-18H,5-6,9-10,12-15H2,1-4H3,(H2,28,29,30,34)/t16-,17+/m1/s1 |
| InChIKey | RBAJTZRKAYVXGN-SJORKVTESA-N |
| XLogP | 2.44 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |