C18H12Cl2F3N3O4 — CID 59508637
5-[3-chloro-4-[(2R,3R)-3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 59508637) has the molecular formula C18H12Cl2F3N3O4 and a molecular weight of 462.21 g/mol. Its IUPAC name is 5-[3-chloro-4-[(2R,3R)-3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]-1,2,4-oxadiazole-3-carboxylic acid.
| Compound Name | 5-[3-chloro-4-[(2R,3R)-3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]-1,2,4-oxadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 59508637 |
| Molecular Formula | C18H12Cl2F3N3O4 |
| Molecular Weight | 462.21 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 5-[3-chloro-4-[(2R,3R)-3-(2-chloro-4-pyridinyl)-4,4,4-trifluoro-3-hydroxybutan-2-yl]phenyl]-1,2,4-oxadiazole-3-carboxylic acid |
| SMILES | C[C@H](c1ccc(-c2nc(C(=O)O)no2)cc1Cl)[C@@](O)(c1ccnc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C18H12Cl2F3N3O4/c1-8(17(29,18(21,22)23)10-4-5-24-13(20)7-10)11-3-2-9(6-12(11)19)15-25-14(16(27)28)26-30-15/h2-8,29H,1H3,(H,27,28)/t8-,17-/m1/s1 |
| InChIKey | HBYZQCBBSFTKIP-CQLKUDPESA-N |
| XLogP | 4.69 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.21 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|