C26H26Cl2N6O4 — CID 59509180
2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-N'-(2,2-dimethylpropanoyl)-3,5-dimethoxybenzohydrazide (PubChem CID 59509180) has the molecular formula C26H26Cl2N6O4 and a molecular weight of 557.44 g/mol. Its IUPAC name is 2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-N'-(2,2-dimethylpropanoyl)-3,5-dimethoxybenzohydrazide.
| Compound Name | 2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-N'-(2,2-dimethylpropanoyl)-3,5-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 59509180 |
| Molecular Formula | C26H26Cl2N6O4 |
| Molecular Weight | 557.44 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-N'-(2,2-dimethylpropanoyl)-3,5-dimethoxybenzohydrazide |
| SMILES | COc1cc(OC)c(-c2nc3ncccn3c2Nc2c(Cl)cccc2Cl)c(C(=O)NNC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C26H26Cl2N6O4/c1-26(2,3)24(36)33-32-23(35)15-12-14(37-4)13-18(38-5)19(15)21-22(34-11-7-10-29-25(34)31-21)30-20-16(27)8-6-9-17(20)28/h6-13,30H,1-5H3,(H,32,35)(H,33,36) |
| InChIKey | AFSSAPOPMOXWCB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|