C23H21Cl2N7O3S — CID 59509183
1-[[2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-3,5-dimethoxybenzoyl]amino]-3-methylthiourea (PubChem CID 59509183) has the molecular formula C23H21Cl2N7O3S and a molecular weight of 546.44 g/mol. Its IUPAC name is 1-[[2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-3,5-dimethoxybenzoyl]amino]-3-methylthiourea.
| Compound Name | 1-[[2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-3,5-dimethoxybenzoyl]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 59509183 |
| Molecular Formula | C23H21Cl2N7O3S |
| Molecular Weight | 546.44 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | 1-[[2-[3-(2,6-dichloroanilino)imidazo[1,2-a]pyrimidin-2-yl]-3,5-dimethoxybenzoyl]amino]-3-methylthiourea |
| SMILES | CNC(=S)NNC(=O)c1cc(OC)cc(OC)c1-c1nc2ncccn2c1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H21Cl2N7O3S/c1-26-23(36)31-30-21(33)13-10-12(34-2)11-16(35-3)17(13)19-20(32-9-5-8-27-22(32)29-19)28-18-14(24)6-4-7-15(18)25/h4-11,28H,1-3H3,(H,30,33)(H2,26,31,36) |
| InChIKey | PHOMGPJPLSYDKQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|