About 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one
2-methyl-2,3-dihydro-1,3-benzothiazin-4-one (PubChem CID 59509224) has the molecular formula C9H9NOS
and a molecular weight of 179.24 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one.
Molecular Properties
| Compound Name | 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one |
| PubChem CID | 59509224 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one |
| SMILES | CC1NC(=O)c2ccccc2S1 |
| InChI | InChI=1S/C9H9NOS/c1-6-10-9(11)7-4-2-3-5-8(7)12-6/h2-6H,1H3,(H,10,11) |
| InChIKey | CJPGWSVYXXCIGI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one?
The IUPAC name of 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one (CID 59509224) is 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one.
What is the SMILES notation for 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one?
The canonical SMILES for 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one is CC1NC(=O)c2ccccc2S1.
What is the InChIKey of 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one?
The InChIKey is CJPGWSVYXXCIGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NOS/c1-6-10-9(11)7-4-2-3-5-8(7)12-6/h2-6H,1H3,(H,10,11).
What are the key properties of 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one?
2-methyl-2,3-dihydro-1,3-benzothiazin-4-one has a molecular weight of 179.24 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3-dihydro-1,3-benzothiazin-4-one is sourced from PubChem (CID 59509224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).