C14H24O — CID 59509303
(2R,3R)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran (PubChem CID 59509303) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (2R,3R)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran.
| Compound Name | (2R,3R)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran |
|---|---|
| PubChem CID | 59509303 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (2R,3R)-2,3,6-trimethyl-6-(4-methylpent-3-enyl)-2,3-dihydropyran |
| SMILES | CC(C)=CCCC1(C)C=C[C@@H](C)[C@@H](C)O1 |
| InChI | InChI=1S/C14H24O/c1-11(2)7-6-9-14(5)10-8-12(3)13(4)15-14/h7-8,10,12-13H,6,9H2,1-5H3/t12-,13-,14?/m1/s1 |
| InChIKey | BBCWGPNEAIPCJC-ZFXTZCCVSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|