C12H18O5 — CID 59509518
[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] hex-5-enoate (PubChem CID 59509518) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is [(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] hex-5-enoate.
| Compound Name | [(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] hex-5-enoate |
|---|---|
| PubChem CID | 59509518 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | [(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] hex-5-enoate |
| SMILES | C=CCCCC(=O)O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
| InChI | InChI=1S/C12H18O5/c1-2-3-4-5-10(14)17-9-7-16-11-8(13)6-15-12(9)11/h2,8-9,11-13H,1,3-7H2/t8-,9-,11-,12-/m1/s1 |
| InChIKey | DZALPUURJGQZKG-CNVPUSNMSA-N |
| XLogP | 0.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|