About 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile
5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile (PubChem CID 59509576) has the molecular formula C10H6N4O
and a molecular weight of 198.19 g/mol. Its IUPAC name is 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile.
Molecular Properties
| Compound Name | 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile |
| PubChem CID | 59509576 |
| Molecular Formula | C10H6N4O |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile |
| SMILES | N#Cc1cc(C=O)ccc1-n1cncn1 |
| InChI | InChI=1S/C10H6N4O/c11-4-9-3-8(5-15)1-2-10(9)14-7-12-6-13-14/h1-3,5-7H |
| InChIKey | DDVOALNPKFRQPQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile?
The IUPAC name of 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile (CID 59509576) is 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile.
What is the SMILES notation for 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile?
The canonical SMILES for 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile is N#Cc1cc(C=O)ccc1-n1cncn1.
What is the InChIKey of 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile?
The InChIKey is DDVOALNPKFRQPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N4O/c11-4-9-3-8(5-15)1-2-10(9)14-7-12-6-13-14/h1-3,5-7H.
What are the key properties of 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile?
5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile has a molecular weight of 198.19 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-formyl-2-(1,2,4-triazol-1-yl)benzonitrile is sourced from PubChem (CID 59509576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).