C22H24F3N5O8S2 — CID 59509619
[(2R,3S,4S,5R)-2-(6-benzamidopurin-9-yl)-5-ethyl-4-methyl-5-(methylsulfonyloxymethyl)oxolan-3-yl] trifluoromethanesulfonate (PubChem CID 59509619) has the molecular formula C22H24F3N5O8S2 and a molecular weight of 607.59 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-2-(6-benzamidopurin-9-yl)-5-ethyl-4-methyl-5-(methylsulfonyloxymethyl)oxolan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,3S,4S,5R)-2-(6-benzamidopurin-9-yl)-5-ethyl-4-methyl-5-(methylsulfonyloxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59509619 |
| Molecular Formula | C22H24F3N5O8S2 |
| Molecular Weight | 607.59 g/mol |
| Exact Mass | 607.10 |
| IUPAC Name | [(2R,3S,4S,5R)-2-(6-benzamidopurin-9-yl)-5-ethyl-4-methyl-5-(methylsulfonyloxymethyl)oxolan-3-yl] trifluoromethanesulfonate |
| SMILES | CC[C@@]1(COS(C)(=O)=O)O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H](OS(=O)(=O)C(F)(F)F)[C@@H]1C |
| InChI | InChI=1S/C22H24F3N5O8S2/c1-4-21(10-36-39(3,32)33)13(2)16(38-40(34,35)22(23,24)25)20(37-21)30-12-28-15-17(26-11-27-18(15)30)29-19(31)14-8-6-5-7-9-14/h5-9,11-13,16,20H,4,10H2,1-3H3,(H,26,27,29,31)/t13-,16-,20+,21-/m0/s1 |
| InChIKey | TXDVXTHXDCUHFA-ISDGYBEFSA-N |
| XLogP | 2.60 |
| TPSA | 168.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.59 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|