C28H38O6Si — CID 59509628
[(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethyl-4-methyloxolan-3-yl] acetate (PubChem CID 59509628) has the molecular formula C28H38O6Si and a molecular weight of 498.69 g/mol. Its IUPAC name is [(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethyl-4-methyloxolan-3-yl] acetate.
| Compound Name | [(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethyl-4-methyloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 59509628 |
| Molecular Formula | C28H38O6Si |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [(3R,4S,5R)-2-acetyloxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethyl-4-methyloxolan-3-yl] acetate |
| SMILES | CC[C@@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(OC(C)=O)[C@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C28H38O6Si/c1-8-28(20(2)25(32-21(3)29)26(34-28)33-22(4)30)19-31-35(27(5,6)7,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,20,25-26H,8,19H2,1-7H3/t20-,25+,26?,28-/m0/s1 |
| InChIKey | NFUROXHKQJMMPX-IWJXAPFUSA-N |
| XLogP | 4.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|