C27H38O4Si — CID 59509658
[(3aR,5R,6S,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 59509658) has the molecular formula C27H38O4Si and a molecular weight of 454.68 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aR,5R,6S,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 59509658 |
| Molecular Formula | C27H38O4Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-ethyl-2,2,6-trimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC[C@@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C27H38O4Si/c1-8-27(20(2)23-24(31-27)30-26(6,7)29-23)19-28-32(25(3,4)5,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,20,23-24H,8,19H2,1-7H3/t20-,23+,24-,27-/m0/s1 |
| InChIKey | HGJPXIWFAYLKRS-YQJHKJFNSA-N |
| XLogP | 4.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|