C25H29FN7O5P — CID 59509683
N-[9-[(1S,3R,4R,7S)-7-[2-cyanoethoxy(methyl)phosphanyl]oxy-1-ethyl-5-(2-fluoroethoxy)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide (PubChem CID 59509683) has the molecular formula C25H29FN7O5P and a molecular weight of 557.52 g/mol. Its IUPAC name is N-[9-[(1S,3R,4R,7S)-7-[2-cyanoethoxy(methyl)phosphanyl]oxy-1-ethyl-5-(2-fluoroethoxy)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide.
| Compound Name | N-[9-[(1S,3R,4R,7S)-7-[2-cyanoethoxy(methyl)phosphanyl]oxy-1-ethyl-5-(2-fluoroethoxy)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide |
|---|---|
| PubChem CID | 59509683 |
| Molecular Formula | C25H29FN7O5P |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | N-[9-[(1S,3R,4R,7S)-7-[2-cyanoethoxy(methyl)phosphanyl]oxy-1-ethyl-5-(2-fluoroethoxy)-2-oxa-5-azabicyclo[2.2.1]heptan-3-yl]purin-6-yl]benzamide |
| SMILES | CC[C@@]12CN(OCCF)[C@@H]([C@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)O1)[C@@H]2OP(C)OCCC#N |
| InChI | InChI=1S/C25H29FN7O5P/c1-3-25-14-33(35-13-10-26)19(20(25)38-39(2)36-12-7-11-27)24(37-25)32-16-30-18-21(28-15-29-22(18)32)31-23(34)17-8-5-4-6-9-17/h4-6,8-9,15-16,19-20,24H,3,7,10,12-14H2,1-2H3,(H,28,29,31,34)/t19-,20+,24-,25+,39?/m1/s1 |
| InChIKey | AYUGEBDLDUGGJK-PIFJGVAFSA-N |
| XLogP | 3.60 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|