C22H21F6N5O8S2 — CID 59509704
[(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-3-methyl-4-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl trifluoromethanesulfonate (PubChem CID 59509704) has the molecular formula C22H21F6N5O8S2 and a molecular weight of 661.56 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-3-methyl-4-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-3-methyl-4-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59509704 |
| Molecular Formula | C22H21F6N5O8S2 |
| Molecular Weight | 661.56 g/mol |
| Exact Mass | 661.07 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(6-benzamidopurin-9-yl)-2-ethyl-3-methyl-4-(trifluoromethylsulfonyloxy)oxolan-2-yl]methyl trifluoromethanesulfonate |
| SMILES | CC[C@@]1(COS(=O)(=O)C(F)(F)F)O[C@@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)[C@@H](OS(=O)(=O)C(F)(F)F)[C@@H]1C |
| InChI | InChI=1S/C22H21F6N5O8S2/c1-3-20(9-39-42(35,36)21(23,24)25)12(2)15(41-43(37,38)22(26,27)28)19(40-20)33-11-31-14-16(29-10-30-17(14)33)32-18(34)13-7-5-4-6-8-13/h4-8,10-12,15,19H,3,9H2,1-2H3,(H,29,30,32,34)/t12-,15-,19+,20-/m0/s1 |
| InChIKey | UPCGYKYXKYTDCO-XUQGBBHRSA-N |
| XLogP | 3.49 |
| TPSA | 168.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|