C11H17NO2 — CID 59509753
2-[(1R,5S,6S)-6-(aminomethyl)-3-methyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (PubChem CID 59509753) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-[(1R,5S,6S)-6-(aminomethyl)-3-methyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid.
| Compound Name | 2-[(1R,5S,6S)-6-(aminomethyl)-3-methyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
|---|---|
| PubChem CID | 59509753 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-[(1R,5S,6S)-6-(aminomethyl)-3-methyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| SMILES | CC1=C[C@@H]2[C@H](C1)C[C@]2(CN)CC(=O)O |
| InChI | InChI=1S/C11H17NO2/c1-7-2-8-4-11(6-12,5-10(13)14)9(8)3-7/h3,8-9H,2,4-6,12H2,1H3,(H,13,14)/t8-,9-,11-/m1/s1 |
| InChIKey | HJNICJYALOSZRL-FXPVBKGRSA-N |
| XLogP | 1.39 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|