C41H30N2O10 — CID 59509836
[4-[2-[4-[2-(2-methylprop-2-enoyl)-1,3-dioxoisoindole-5-carbonyl]oxyphenyl]propan-2-yl]phenyl] 2-(2-methylprop-2-enoyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 59509836) has the molecular formula C41H30N2O10 and a molecular weight of 710.69 g/mol. Its IUPAC name is [4-[2-[4-[2-(2-methylprop-2-enoyl)-1,3-dioxoisoindole-5-carbonyl]oxyphenyl]propan-2-yl]phenyl] 2-(2-methylprop-2-enoyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-[2-[4-[2-(2-methylprop-2-enoyl)-1,3-dioxoisoindole-5-carbonyl]oxyphenyl]propan-2-yl]phenyl] 2-(2-methylprop-2-enoyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 59509836 |
| Molecular Formula | C41H30N2O10 |
| Molecular Weight | 710.69 g/mol |
| Exact Mass | 710.19 |
| IUPAC Name | [4-[2-[4-[2-(2-methylprop-2-enoyl)-1,3-dioxoisoindole-5-carbonyl]oxyphenyl]propan-2-yl]phenyl] 2-(2-methylprop-2-enoyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | C=C(C)C(=O)N1C(=O)c2ccc(C(=O)Oc3ccc(C(C)(C)c4ccc(OC(=O)c5ccc6c(c5)C(=O)N(C(=O)C(=C)C)C6=O)cc4)cc3)cc2C1=O |
| InChI | InChI=1S/C41H30N2O10/c1-21(2)33(44)42-35(46)29-17-7-23(19-31(29)37(42)48)39(50)52-27-13-9-25(10-14-27)41(5,6)26-11-15-28(16-12-26)53-40(51)24-8-18-30-32(20-24)38(49)43(36(30)47)34(45)22(3)4/h7-20H,1,3H2,2,4-6H3 |
| InChIKey | GPVVKWBDDZJOAM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 161.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.69 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|