C5Cl6F6O — CID 59509974
1,2,3-trichloro-1,1,2,3-tetrafluoro-3-(1,2,2-trichloro-1,2-difluoroethoxy)propane (PubChem CID 59509974) has the molecular formula C5Cl6F6O and a molecular weight of 402.76 g/mol. Its IUPAC name is 1,2,3-trichloro-1,1,2,3-tetrafluoro-3-(1,2,2-trichloro-1,2-difluoroethoxy)propane.
| Compound Name | 1,2,3-trichloro-1,1,2,3-tetrafluoro-3-(1,2,2-trichloro-1,2-difluoroethoxy)propane |
|---|---|
| PubChem CID | 59509974 |
| Molecular Formula | C5Cl6F6O |
| Molecular Weight | 402.76 g/mol |
| Exact Mass | 399.80 |
| IUPAC Name | 1,2,3-trichloro-1,1,2,3-tetrafluoro-3-(1,2,2-trichloro-1,2-difluoroethoxy)propane |
| SMILES | FC(F)(Cl)C(F)(Cl)C(F)(Cl)OC(F)(Cl)C(F)(Cl)Cl |
| InChI | InChI=1S/C5Cl6F6O/c6-1(12,3(9,14)15)4(10,16)18-5(11,17)2(7,8)13 |
| InChIKey | YEWZUNDSHQPIPO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.76 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|