C4H2Cl6F2O — CID 59509988
1,1,2-trichloro-1,2-difluoro-2-(2,2,2-trichloroethoxy)ethane (PubChem CID 59509988) has the molecular formula C4H2Cl6F2O and a molecular weight of 316.77 g/mol. Its IUPAC name is 1,1,2-trichloro-1,2-difluoro-2-(2,2,2-trichloroethoxy)ethane.
| Compound Name | 1,1,2-trichloro-1,2-difluoro-2-(2,2,2-trichloroethoxy)ethane |
|---|---|
| PubChem CID | 59509988 |
| Molecular Formula | C4H2Cl6F2O |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 313.82 |
| IUPAC Name | 1,1,2-trichloro-1,2-difluoro-2-(2,2,2-trichloroethoxy)ethane |
| SMILES | FC(Cl)(Cl)C(F)(Cl)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H2Cl6F2O/c5-2(6,7)1-13-4(10,12)3(8,9)11/h1H2 |
| InChIKey | QPZZMMKCEAIEIC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|