C17H26FN3O4 — CID 59510447
pentyl N-[5-fluoro-2-oxo-1-[(2R,3S,5R)-3,4,5-trimethyloxolan-2-yl]pyrimidin-4-yl]carbamate (PubChem CID 59510447) has the molecular formula C17H26FN3O4 and a molecular weight of 355.41 g/mol. Its IUPAC name is pentyl N-[5-fluoro-2-oxo-1-[(2R,3S,5R)-3,4,5-trimethyloxolan-2-yl]pyrimidin-4-yl]carbamate.
| Compound Name | pentyl N-[5-fluoro-2-oxo-1-[(2R,3S,5R)-3,4,5-trimethyloxolan-2-yl]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 59510447 |
| Molecular Formula | C17H26FN3O4 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | pentyl N-[5-fluoro-2-oxo-1-[(2R,3S,5R)-3,4,5-trimethyloxolan-2-yl]pyrimidin-4-yl]carbamate |
| SMILES | CCCCCOC(=O)Nc1nc(=O)n([C@@H]2O[C@H](C)C(C)[C@@H]2C)cc1F |
| InChI | InChI=1S/C17H26FN3O4/c1-5-6-7-8-24-17(23)20-14-13(18)9-21(16(22)19-14)15-11(3)10(2)12(4)25-15/h9-12,15H,5-8H2,1-4H3,(H,19,20,22,23)/t10?,11-,12+,15+/m0/s1 |
| InChIKey | UDUGTBFXMJFFLG-WBSDXNHYSA-N |
| XLogP | 3.31 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|