C13H26N2O3 — CID 59510532
1-[(2Z)-2-methoxyiminopropoxy]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 59510532) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-[(2Z)-2-methoxyiminopropoxy]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[(2Z)-2-methoxyiminopropoxy]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 59510532 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 1-[(2Z)-2-methoxyiminopropoxy]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CO/N=C(/C)CON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-10(14-17-6)9-18-15-12(2,3)7-11(16)8-13(15,4)5/h11,16H,7-9H2,1-6H3/b14-10- |
| InChIKey | DEXJLFGGPNXEQH-UVTDQMKNSA-N |
| XLogP | 1.95 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|