C12H26NO5P — CID 59510539
1-(dimethoxyphosphorylmethoxy)-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 59510539) has the molecular formula C12H26NO5P and a molecular weight of 295.32 g/mol. Its IUPAC name is 1-(dimethoxyphosphorylmethoxy)-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-(dimethoxyphosphorylmethoxy)-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 59510539 |
| Molecular Formula | C12H26NO5P |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-(dimethoxyphosphorylmethoxy)-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | COP(=O)(CON1C(C)(C)CC(O)CC1(C)C)OC |
| InChI | InChI=1S/C12H26NO5P/c1-11(2)7-10(14)8-12(3,4)13(11)18-9-19(15,16-5)17-6/h10,14H,7-9H2,1-6H3 |
| InChIKey | OEGYJUGZLOKVBT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|