C29H17Br2N3 — CID 59510707
2-(3,5-dibromophenyl)-4,6-dinaphthalen-1-yl-1,3,5-triazine (PubChem CID 59510707) has the molecular formula C29H17Br2N3 and a molecular weight of 567.28 g/mol. Its IUPAC name is 2-(3,5-dibromophenyl)-4,6-dinaphthalen-1-yl-1,3,5-triazine.
| Compound Name | 2-(3,5-dibromophenyl)-4,6-dinaphthalen-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 59510707 |
| Molecular Formula | C29H17Br2N3 |
| Molecular Weight | 567.28 g/mol |
| Exact Mass | 564.98 |
| IUPAC Name | 2-(3,5-dibromophenyl)-4,6-dinaphthalen-1-yl-1,3,5-triazine |
| SMILES | Brc1cc(Br)cc(-c2nc(-c3cccc4ccccc34)nc(-c3cccc4ccccc34)n2)c1 |
| InChI | InChI=1S/C29H17Br2N3/c30-21-15-20(16-22(31)17-21)27-32-28(25-13-5-9-18-7-1-3-11-23(18)25)34-29(33-27)26-14-6-10-19-8-2-4-12-24(19)26/h1-17H |
| InChIKey | LBGROGPNCRIBIM-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.28 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |