About CID 59510817
CID 59510817 (PubChem CID 59510817) has the molecular formula C47H104O5Si6
and a molecular weight of 917.86 g/mol.
Molecular Properties
| Compound Name | CID 59510817 |
| PubChem CID | 59510817 |
| Molecular Formula | C47H104O5Si6 |
| Molecular Weight | 917.86 g/mol |
| Exact Mass | 916.65 |
| IUPAC Name | — |
| SMILES | [CH]CCOCCCC(C)(C(C)(CC[Si](C)(C)CO[Si](C)(C)CCC(C)(C(C)(C)O[Si](C)(C)C)C(C)(CCCOCC[CH])[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C47H104O5Si6/c1-27-35-48-37-29-31-46(9,53(11,12)13)44(7,42(3,4)51-55(17,18)19)33-39-57(23,24)41-50-58(25,26)40-34-45(8,43(5,6)52-56(20,21)22)47(10,54(14,15)16)32-30-38-49-36-28-2/h1-2H,27-41H2,3-26H3 |
| InChIKey | XAGILAVDVJZFEB-UHFFFAOYSA-N |
| XLogP | 15.50 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 917.86 |
| LogP ≤ 5 | 15.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59510817 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59510817?
The IUPAC name of CID 59510817 (CID 59510817) is not available.
What is the SMILES notation for CID 59510817?
The canonical SMILES for CID 59510817 is [CH]CCOCCCC(C)(C(C)(CC[Si](C)(C)CO[Si](C)(C)CCC(C)(C(C)(C)O[Si](C)(C)C)C(C)(CCCOCC[CH])[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of CID 59510817?
The InChIKey is XAGILAVDVJZFEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C47H104O5Si6/c1-27-35-48-37-29-31-46(9,53(11,12)13)44(7,42(3,4)51-55(17,18)19)33-39-57(23,24)41-50-58(25,26)40-34-45(8,43(5,6)52-56(20,21)22)47(10,54(14,15)16)32-30-38-49-36-28-2/h1-2H,27-41H2,3-26H3.
What are the key properties of CID 59510817?
CID 59510817 has a molecular weight of 917.86 g/mol, XLogP of 15.50, 31 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59510817 is sourced from PubChem (CID 59510817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).