About 1-(4-butylphenyl)-2,2,2-trifluoroethanone
1-(4-butylphenyl)-2,2,2-trifluoroethanone (PubChem CID 595109) has the molecular formula C12H13F3O
and a molecular weight of 230.23 g/mol. Its IUPAC name is 1-(4-butylphenyl)-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-(4-butylphenyl)-2,2,2-trifluoroethanone |
| PubChem CID | 595109 |
| Molecular Formula | C12H13F3O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-(4-butylphenyl)-2,2,2-trifluoroethanone |
| SMILES | CCCCc1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3O/c1-2-3-4-9-5-7-10(8-6-9)11(16)12(13,14)15/h5-8H,2-4H2,1H3 |
| InChIKey | XIVOMWSWGCFRNB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-butylphenyl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-butylphenyl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(4-butylphenyl)-2,2,2-trifluoroethanone (CID 595109) is 1-(4-butylphenyl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(4-butylphenyl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(4-butylphenyl)-2,2,2-trifluoroethanone is CCCCc1ccc(C(=O)C(F)(F)F)cc1.
What is the InChIKey of 1-(4-butylphenyl)-2,2,2-trifluoroethanone?
The InChIKey is XIVOMWSWGCFRNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O/c1-2-3-4-9-5-7-10(8-6-9)11(16)12(13,14)15/h5-8H,2-4H2,1H3.
What are the key properties of 1-(4-butylphenyl)-2,2,2-trifluoroethanone?
1-(4-butylphenyl)-2,2,2-trifluoroethanone has a molecular weight of 230.23 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-butylphenyl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 595109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).