About [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate
[4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 59510981) has the molecular formula C21H14F3O2S+
and a molecular weight of 387.40 g/mol. Its IUPAC name is [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate |
| PubChem CID | 59510981 |
| Molecular Formula | C21H14F3O2S+ |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1ccc([S+]2c3ccccc3Cc3ccccc32)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H14F3O2S/c22-21(23,24)20(25)26-16-9-11-17(12-10-16)27-18-7-3-1-5-14(18)13-15-6-2-4-8-19(15)27/h1-12H,13H2/q+1 |
| InChIKey | NQWNYXTTZHVCMV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate?
The IUPAC name of [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate (CID 59510981) is [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate.
What is the SMILES notation for [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate?
The canonical SMILES for [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate is O=C(Oc1ccc([S+]2c3ccccc3Cc3ccccc32)cc1)C(F)(F)F.
What is the InChIKey of [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate?
The InChIKey is NQWNYXTTZHVCMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14F3O2S/c22-21(23,24)20(25)26-16-9-11-17(12-10-16)27-18-7-3-1-5-14(18)13-15-6-2-4-8-19(15)27/h1-12H,13H2/q+1.
What are the key properties of [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate?
[4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate has a molecular weight of 387.40 g/mol, XLogP of 5.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 59510981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).