C23H18F3O2S+ — CID 59510983
[2,6-dimethyl-4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 59510983) has the molecular formula C23H18F3O2S+ and a molecular weight of 415.46 g/mol. Its IUPAC name is [2,6-dimethyl-4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2,6-dimethyl-4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 59510983 |
| Molecular Formula | C23H18F3O2S+ |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [2,6-dimethyl-4-(9H-thioxanthen-10-ium-10-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc([S+]2c3ccccc3Cc3ccccc32)cc(C)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C23H18F3O2S/c1-14-11-18(12-15(2)21(14)28-22(27)23(24,25)26)29-19-9-5-3-7-16(19)13-17-8-4-6-10-20(17)29/h3-12H,13H2,1-2H3/q+1 |
| InChIKey | UTFHZKULKQYFDG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|