C9H9F3N2O3 — CID 59511121
N-[3-(2,5-dioxopyrrol-1-yl)propyl]-2,2,2-trifluoroacetamide (PubChem CID 59511121) has the molecular formula C9H9F3N2O3 and a molecular weight of 250.18 g/mol. Its IUPAC name is N-[3-(2,5-dioxopyrrol-1-yl)propyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-(2,5-dioxopyrrol-1-yl)propyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 59511121 |
| Molecular Formula | C9H9F3N2O3 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | N-[3-(2,5-dioxopyrrol-1-yl)propyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1C=CC(=O)N1CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H9F3N2O3/c10-9(11,12)8(17)13-4-1-5-14-6(15)2-3-7(14)16/h2-3H,1,4-5H2,(H,13,17) |
| InChIKey | BXHVVPHGDRMBKW-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|