C13H16N4 — CID 59511191
1-(5-phenyl-1H-pyrazol-4-yl)piperazine (PubChem CID 59511191) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 1-(5-phenyl-1H-pyrazol-4-yl)piperazine.
| Compound Name | 1-(5-phenyl-1H-pyrazol-4-yl)piperazine |
|---|---|
| PubChem CID | 59511191 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-(5-phenyl-1H-pyrazol-4-yl)piperazine |
| SMILES | c1ccc(-c2[nH]ncc2N2CCNCC2)cc1 |
| InChI | InChI=1S/C13H16N4/c1-2-4-11(5-3-1)13-12(10-15-16-13)17-8-6-14-7-9-17/h1-5,10,14H,6-9H2,(H,15,16) |
| InChIKey | RUQQBOVFRBIOBE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |