About pyrido[3,4-c][1,2,6]oxathiazine
pyrido[3,4-c][1,2,6]oxathiazine (PubChem CID 59512441) has the molecular formula C6H4N2OS
and a molecular weight of 152.18 g/mol. Its IUPAC name is pyrido[3,4-c][1,2,6]oxathiazine.
Molecular Properties
| Compound Name | pyrido[3,4-c][1,2,6]oxathiazine |
| PubChem CID | 59512441 |
| Molecular Formula | C6H4N2OS |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.00 |
| IUPAC Name | pyrido[3,4-c][1,2,6]oxathiazine |
| SMILES | C1=NOSc2cnccc21 |
| InChI | InChI=1S/C6H4N2OS/c1-2-7-4-6-5(1)3-8-9-10-6/h1-4H |
| InChIKey | LWBGZEPZHXZBIG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pyrido[3,4-c][1,2,6]oxathiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[3,4-c][1,2,6]oxathiazine?
The IUPAC name of pyrido[3,4-c][1,2,6]oxathiazine (CID 59512441) is pyrido[3,4-c][1,2,6]oxathiazine.
What is the SMILES notation for pyrido[3,4-c][1,2,6]oxathiazine?
The canonical SMILES for pyrido[3,4-c][1,2,6]oxathiazine is C1=NOSc2cnccc21.
What is the InChIKey of pyrido[3,4-c][1,2,6]oxathiazine?
The InChIKey is LWBGZEPZHXZBIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2OS/c1-2-7-4-6-5(1)3-8-9-10-6/h1-4H.
What are the key properties of pyrido[3,4-c][1,2,6]oxathiazine?
pyrido[3,4-c][1,2,6]oxathiazine has a molecular weight of 152.18 g/mol, XLogP of 1.45, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[3,4-c][1,2,6]oxathiazine is sourced from PubChem (CID 59512441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).