C21H21NO8 — CID 59512779
(4S,4aS,5aS,6S,12aR)-1,6,10,11,12a-pentahydroxy-4,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 59512779) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is (4S,4aS,5aS,6S,12aR)-1,6,10,11,12a-pentahydroxy-4,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aS,6S,12aR)-1,6,10,11,12a-pentahydroxy-4,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 59512779 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (4S,4aS,5aS,6S,12aR)-1,6,10,11,12a-pentahydroxy-4,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | C[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@@](C)(O)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C21H21NO8/c1-7-9-6-10-13(16(25)12-8(20(10,2)29)4-3-5-11(12)23)17(26)21(9,30)18(27)14(15(7)24)19(22)28/h3-5,7,9-10,23,25,27,29-30H,6H2,1-2H3,(H2,22,28)/t7-,9-,10-,20+,21-/m0/s1 |
| InChIKey | HPHNBENLUWNGFO-IEWBRLGQSA-N |
| XLogP | 0.33 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|